C18H21NO4 — CID 162936543
(5aR,11bS,11cR)-9,10-dimethoxy-1-methyl-2,3,5,5a,11b,11c-hexahydroisochromeno[3,4-g]indol-7-one (PubChem CID 162936543) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (5aR,11bS,11cR)-9,10-dimethoxy-1-methyl-2,3,5,5a,11b,11c-hexahydroisochromeno[3,4-g]indol-7-one.
| Compound Name | (5aR,11bS,11cR)-9,10-dimethoxy-1-methyl-2,3,5,5a,11b,11c-hexahydroisochromeno[3,4-g]indol-7-one |
|---|---|
| PubChem CID | 162936543 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (5aR,11bS,11cR)-9,10-dimethoxy-1-methyl-2,3,5,5a,11b,11c-hexahydroisochromeno[3,4-g]indol-7-one |
| SMILES | COc1cc2c(cc1OC)[C@@H]1[C@@H](CC=C3CCN(C)[C@@H]31)OC2=O |
| InChI | InChI=1S/C18H21NO4/c1-19-7-6-10-4-5-13-16(17(10)19)11-8-14(21-2)15(22-3)9-12(11)18(20)23-13/h4,8-9,13,16-17H,5-7H2,1-3H3/t13-,16-,17+/m1/s1 |
| InChIKey | WXZAKVLYZHWSNF-XYPHTWIQSA-N |
| XLogP | 2.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|