C20H27NO5 — CID 163034167
(5S,5aS,7S,11bS,11cS)-5,7,9,10-tetramethoxy-1-methyl-3,5,5a,7,11b,11c-hexahydro-2H-isochromeno[3,4-g]indole (PubChem CID 163034167) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is (5S,5aS,7S,11bS,11cS)-5,7,9,10-tetramethoxy-1-methyl-3,5,5a,7,11b,11c-hexahydro-2H-isochromeno[3,4-g]indole.
| Compound Name | (5S,5aS,7S,11bS,11cS)-5,7,9,10-tetramethoxy-1-methyl-3,5,5a,7,11b,11c-hexahydro-2H-isochromeno[3,4-g]indole |
|---|---|
| PubChem CID | 163034167 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (5S,5aS,7S,11bS,11cS)-5,7,9,10-tetramethoxy-1-methyl-3,5,5a,7,11b,11c-hexahydro-2H-isochromeno[3,4-g]indole |
| SMILES | COc1cc2c(cc1OC)[C@@H]1[C@H](O[C@@H]2OC)[C@@H](OC)C=C2CCN(C)[C@H]21 |
| InChI | InChI=1S/C20H27NO5/c1-21-7-6-11-8-16(24-4)19-17(18(11)21)12-9-14(22-2)15(23-3)10-13(12)20(25-5)26-19/h8-10,16-20H,6-7H2,1-5H3/t16-,17-,18+,19+,20-/m0/s1 |
| InChIKey | IFQRJDGCHMHOMX-OMZCGLGVSA-N |
| XLogP | 2.49 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|