C18H23NO4 — CID 162888351
2-(6-hydroxy-1-methyl-2,3,5,6,7,7a-hexahydroindol-7-yl)-4,5-dimethoxybenzaldehyde (PubChem CID 162888351) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(6-hydroxy-1-methyl-2,3,5,6,7,7a-hexahydroindol-7-yl)-4,5-dimethoxybenzaldehyde.
| Compound Name | 2-(6-hydroxy-1-methyl-2,3,5,6,7,7a-hexahydroindol-7-yl)-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 162888351 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-(6-hydroxy-1-methyl-2,3,5,6,7,7a-hexahydroindol-7-yl)-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(C2C(O)CC=C3CCN(C)C32)cc1OC |
| InChI | InChI=1S/C18H23NO4/c1-19-7-6-11-4-5-14(21)17(18(11)19)13-9-16(23-3)15(22-2)8-12(13)10-20/h4,8-10,14,17-18,21H,5-7H2,1-3H3 |
| InChIKey | BPLYDGFDIPPTEO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|