C22H28O5 — CID 162936681
3-[3-[(4R)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl]-4-methoxyphenyl]prop-2-enoic acid (PubChem CID 162936681) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is 3-[3-[(4R)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl]-4-methoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(4R)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl]-4-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162936681 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 3-[3-[(4R)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl]-4-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(C=CC(=O)O)cc1CC=C(C)[C@@H](CC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C22H28O5/c1-15(2)6-11-20(27-17(4)23)16(3)7-10-19-14-18(9-13-22(24)25)8-12-21(19)26-5/h6-9,12-14,20H,10-11H2,1-5H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | BNKBJTGWXDOAKC-HXUWFJFHSA-N |
| XLogP | 4.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|