C23H28O4 — CID 142412515
(E)-3-[4-[(Z,4Z)-4-ethylidenehept-5-enoyl]oxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid (PubChem CID 142412515) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (E)-3-[4-[(Z,4Z)-4-ethylidenehept-5-enoyl]oxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(Z,4Z)-4-ethylidenehept-5-enoyl]oxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 142412515 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (E)-3-[4-[(Z,4Z)-4-ethylidenehept-5-enoyl]oxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid |
| SMILES | C/C=C\C(=C/C)CCC(=O)Oc1ccc(/C=C/C(=O)O)cc1CC=C(C)C |
| InChI | InChI=1S/C23H28O4/c1-5-7-18(6-2)11-15-23(26)27-21-13-9-19(10-14-22(24)25)16-20(21)12-8-17(3)4/h5-10,13-14,16H,11-12,15H2,1-4H3,(H,24,25)/b7-5-,14-10+,18-6+ |
| InChIKey | YYSUPXCDFVHDPN-GOXZWPLASA-N |
| XLogP | 5.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|