C27H31NO6 — CID 164613310
benzyl (2S,3R)-2-[[(E)-3-[4-acetyloxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoyl]amino]-3-hydroxybutanoate (PubChem CID 164613310) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is benzyl (2S,3R)-2-[[(E)-3-[4-acetyloxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoyl]amino]-3-hydroxybutanoate.
| Compound Name | benzyl (2S,3R)-2-[[(E)-3-[4-acetyloxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoyl]amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 164613310 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | benzyl (2S,3R)-2-[[(E)-3-[4-acetyloxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoyl]amino]-3-hydroxybutanoate |
| SMILES | CC(=O)Oc1ccc(/C=C/C(=O)N[C@H](C(=O)OCc2ccccc2)[C@@H](C)O)cc1CC=C(C)C |
| InChI | InChI=1S/C27H31NO6/c1-18(2)10-13-23-16-21(11-14-24(23)34-20(4)30)12-15-25(31)28-26(19(3)29)27(32)33-17-22-8-6-5-7-9-22/h5-12,14-16,19,26,29H,13,17H2,1-4H3,(H,28,31)/b15-12+/t19-,26+/m1/s1 |
| InChIKey | HWSBPLCZGNEYHD-FUUXVATDSA-N |
| XLogP | 3.74 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|