C21H30O4 — CID 162939095
9-phenyl-1-[(1S,2R,6S)-2,4,6-trihydroxycyclohex-3-en-1-yl]nonan-1-one (PubChem CID 162939095) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 9-phenyl-1-[(1S,2R,6S)-2,4,6-trihydroxycyclohex-3-en-1-yl]nonan-1-one.
| Compound Name | 9-phenyl-1-[(1S,2R,6S)-2,4,6-trihydroxycyclohex-3-en-1-yl]nonan-1-one |
|---|---|
| PubChem CID | 162939095 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 9-phenyl-1-[(1S,2R,6S)-2,4,6-trihydroxycyclohex-3-en-1-yl]nonan-1-one |
| SMILES | O=C(CCCCCCCCc1ccccc1)[C@@H]1[C@H](O)C=C(O)C[C@@H]1O |
| InChI | InChI=1S/C21H30O4/c22-17-14-19(24)21(20(25)15-17)18(23)13-9-4-2-1-3-6-10-16-11-7-5-8-12-16/h5,7-8,11-12,14,19-22,24-25H,1-4,6,9-10,13,15H2/t19-,20+,21-/m1/s1 |
| InChIKey | OHWWYOHXWKGLHF-QHAWAJNXSA-N |
| XLogP | 3.71 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|