C21H28O4 — CID 95223200
cis-(2R,4S)-4-hydroxy-2-(9-phenylnonanoyl)cyclohexane-1,3-dione (PubChem CID 95223200) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is cis-(2R,4S)-4-hydroxy-2-(9-phenylnonanoyl)cyclohexane-1,3-dione.
| Compound Name | cis-(2R,4S)-4-hydroxy-2-(9-phenylnonanoyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 95223200 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | cis-(2R,4S)-4-hydroxy-2-(9-phenylnonanoyl)cyclohexane-1,3-dione |
| SMILES | O=C(CCCCCCCCc1ccccc1)[C@@H]1C(=O)CC[C@H](O)C1=O |
| InChI | InChI=1S/C21H28O4/c22-17(20-18(23)14-15-19(24)21(20)25)13-9-4-2-1-3-6-10-16-11-7-5-8-12-16/h5,7-8,11-12,19-20,24H,1-4,6,9-10,13-15H2/t19-,20+/m0/s1 |
| InChIKey | NBUUXVYUAWHXAA-VQTJNVASSA-N |
| XLogP | 3.44 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|