C15H28O3 — CID 162940182
(1R,3aR,4S,7R,8aR)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-1,2,3,4,5,6,7,8-octahydroazulene-3a,8a-diol (PubChem CID 162940182) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (1R,3aR,4S,7R,8aR)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-1,2,3,4,5,6,7,8-octahydroazulene-3a,8a-diol.
| Compound Name | (1R,3aR,4S,7R,8aR)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-1,2,3,4,5,6,7,8-octahydroazulene-3a,8a-diol |
|---|---|
| PubChem CID | 162940182 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (1R,3aR,4S,7R,8aR)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-1,2,3,4,5,6,7,8-octahydroazulene-3a,8a-diol |
| SMILES | C[C@@H]1CC[C@@]2(O)[C@@H](C)CC[C@@H](C(C)(C)O)C[C@@]12O |
| InChI | InChI=1S/C15H28O3/c1-10-5-6-12(13(3,4)16)9-15(18)11(2)7-8-14(10,15)17/h10-12,16-18H,5-9H2,1-4H3/t10-,11+,12+,14+,15+/m0/s1 |
| InChIKey | DOXUCYLASNZSCE-PGKPSXLWSA-N |
| XLogP | 2.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |