C28H46O7 — CID 162943963
[(2S,3R,4S,5S,6R)-4-acetyloxy-5-hydroxy-6-methyl-2-[(2R)-6-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-yl]oxyoxan-3-yl] (2R)-2-methylbutanoate (PubChem CID 162943963) has the molecular formula C28H46O7 and a molecular weight of 494.67 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4-acetyloxy-5-hydroxy-6-methyl-2-[(2R)-6-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-yl]oxyoxan-3-yl] (2R)-2-methylbutanoate.
| Compound Name | [(2S,3R,4S,5S,6R)-4-acetyloxy-5-hydroxy-6-methyl-2-[(2R)-6-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-yl]oxyoxan-3-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 162943963 |
| Molecular Formula | C28H46O7 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4-acetyloxy-5-hydroxy-6-methyl-2-[(2R)-6-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-yl]oxyoxan-3-yl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)O[C@H]1[C@H](O[C@](C)(CCC=C(C)C)[C@@H]2CC=C(C)CC2)O[C@H](C)[C@H](O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H46O7/c1-9-19(5)26(31)34-25-24(33-21(7)29)23(30)20(6)32-27(25)35-28(8,16-10-11-17(2)3)22-14-12-18(4)13-15-22/h11-12,19-20,22-25,27,30H,9-10,13-16H2,1-8H3/t19-,20-,22-,23+,24+,25-,27+,28-/m1/s1 |
| InChIKey | YHFXKXXRWVLNRZ-HUEFRVMCSA-N |
| XLogP | 5.25 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|