C38H44O9 — CID 162944966
8-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-6-(3,7-dimethylocta-2,6-dienyl)-4-(3-hydroxy-4-oxopyran-2-yl)-2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydrochromene-5,7-dione (PubChem CID 162944966) has the molecular formula C38H44O9 and a molecular weight of 644.76 g/mol. Its IUPAC name is 8-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-6-(3,7-dimethylocta-2,6-dienyl)-4-(3-hydroxy-4-oxopyran-2-yl)-2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydrochromene-5,7-dione.
| Compound Name | 8-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-6-(3,7-dimethylocta-2,6-dienyl)-4-(3-hydroxy-4-oxopyran-2-yl)-2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydrochromene-5,7-dione |
|---|---|
| PubChem CID | 162944966 |
| Molecular Formula | C38H44O9 |
| Molecular Weight | 644.76 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | 8-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-6-(3,7-dimethylocta-2,6-dienyl)-4-(3-hydroxy-4-oxopyran-2-yl)-2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydrochromene-5,7-dione |
| SMILES | CC(C)=CCCC(C)=CCC1(CC=C(C)C)C(=O)C(=C(O)c2ccc(O)c(O)c2)C2=C(C1=O)C(c1occc(=O)c1O)CC(C)(C)O2 |
| InChI | InChI=1S/C38H44O9/c1-21(2)9-8-10-23(5)14-17-38(16-13-22(3)4)35(44)29-25(33-32(43)27(40)15-18-46-33)20-37(6,7)47-34(29)30(36(38)45)31(42)24-11-12-26(39)28(41)19-24/h9,11-15,18-19,25,39,41-43H,8,10,16-17,20H2,1-7H3 |
| InChIKey | OMWSOXHVURFRQR-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.76 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|