C21H32O7 — CID 162947562
[(2Z,5S,6Z,10R)-5-acetyloxy-7-(acetyloxymethyl)-10-hydroxy-3,11-dimethyldodeca-2,6,11-trienyl] acetate (PubChem CID 162947562) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is [(2Z,5S,6Z,10R)-5-acetyloxy-7-(acetyloxymethyl)-10-hydroxy-3,11-dimethyldodeca-2,6,11-trienyl] acetate.
| Compound Name | [(2Z,5S,6Z,10R)-5-acetyloxy-7-(acetyloxymethyl)-10-hydroxy-3,11-dimethyldodeca-2,6,11-trienyl] acetate |
|---|---|
| PubChem CID | 162947562 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | [(2Z,5S,6Z,10R)-5-acetyloxy-7-(acetyloxymethyl)-10-hydroxy-3,11-dimethyldodeca-2,6,11-trienyl] acetate |
| SMILES | C=C(C)[C@H](O)CC/C(=C/[C@H](C/C(C)=C\COC(C)=O)OC(C)=O)COC(C)=O |
| InChI | InChI=1S/C21H32O7/c1-14(2)21(25)8-7-19(13-27-17(5)23)12-20(28-18(6)24)11-15(3)9-10-26-16(4)22/h9,12,20-21,25H,1,7-8,10-11,13H2,2-6H3/b15-9-,19-12-/t20-,21+/m0/s1 |
| InChIKey | OMBKFHNXWHDAKA-JZPUQMNRSA-N |
| XLogP | 3.02 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|