C23H30O7 — CID 162950013
8-hydroxy-1,3-dimethoxy-6-methyl-5-prop-2-enyl-7-(3,4,5-trimethoxyphenyl)bicyclo[3.2.1]oct-3-en-2-one (PubChem CID 162950013) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is 8-hydroxy-1,3-dimethoxy-6-methyl-5-prop-2-enyl-7-(3,4,5-trimethoxyphenyl)bicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | 8-hydroxy-1,3-dimethoxy-6-methyl-5-prop-2-enyl-7-(3,4,5-trimethoxyphenyl)bicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 162950013 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 8-hydroxy-1,3-dimethoxy-6-methyl-5-prop-2-enyl-7-(3,4,5-trimethoxyphenyl)bicyclo[3.2.1]oct-3-en-2-one |
| SMILES | C=CCC12C=C(OC)C(=O)C(OC)(C(c3cc(OC)c(OC)c(OC)c3)C1C)C2O |
| InChI | InChI=1S/C23H30O7/c1-8-9-22-12-17(28-5)20(24)23(30-7,21(22)25)18(13(22)2)14-10-15(26-3)19(29-6)16(11-14)27-4/h8,10-13,18,21,25H,1,9H2,2-7H3 |
| InChIKey | ZCJMDSUDHMUDFJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|