C25H39NO7 — CID 162950182
14-ethyl-4,19-dimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane-6,21-diol (PubChem CID 162950182) has the molecular formula C25H39NO7 and a molecular weight of 465.59 g/mol. Its IUPAC name is 14-ethyl-4,19-dimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane-6,21-diol.
| Compound Name | 14-ethyl-4,19-dimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane-6,21-diol |
|---|---|
| PubChem CID | 162950182 |
| Molecular Formula | C25H39NO7 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 14-ethyl-4,19-dimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane-6,21-diol |
| SMILES | CCN1CC2(COC)CCC(OC)C34C5CC6C(O)CC7(OCOC7(C(O)C23)C14)C5C6OC |
| InChI | InChI=1S/C25H39NO7/c1-5-26-10-22(11-29-2)7-6-16(30-3)24-14-8-13-15(27)9-23(17(14)18(13)31-4)25(21(24)26,33-12-32-23)20(28)19(22)24/h13-21,27-28H,5-12H2,1-4H3 |
| InChIKey | LPVPZGIMGQGDTR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |