C17H27NO2 — CID 162955929
(E,3R,4S)-7-[(5S,8R,8aS)-8-ethyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]hept-6-en-1-yne-3,4-diol (PubChem CID 162955929) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (E,3R,4S)-7-[(5S,8R,8aS)-8-ethyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]hept-6-en-1-yne-3,4-diol.
| Compound Name | (E,3R,4S)-7-[(5S,8R,8aS)-8-ethyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]hept-6-en-1-yne-3,4-diol |
|---|---|
| PubChem CID | 162955929 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (E,3R,4S)-7-[(5S,8R,8aS)-8-ethyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]hept-6-en-1-yne-3,4-diol |
| SMILES | C#C[C@@H](O)[C@@H](O)C/C=C/[C@@H]1CC[C@@H](CC)[C@@H]2CCCN12 |
| InChI | InChI=1S/C17H27NO2/c1-3-13-10-11-14(18-12-6-8-15(13)18)7-5-9-17(20)16(19)4-2/h2,5,7,13-17,19-20H,3,6,8-12H2,1H3/b7-5+/t13-,14-,15+,16-,17+/m1/s1 |
| InChIKey | BJZNKVVNWYSPBY-YXJVKMGSSA-N |
| XLogP | 1.94 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|