C25H34O6 — CID 162957936
[(1R,2R,8aR)-5-hydroxy-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (Z)-3-methyl-4-[(Z)-2-methylbut-2-enoyl]oxybut-2-enoate (PubChem CID 162957936) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [(1R,2R,8aR)-5-hydroxy-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (Z)-3-methyl-4-[(Z)-2-methylbut-2-enoyl]oxybut-2-enoate.
| Compound Name | [(1R,2R,8aR)-5-hydroxy-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (Z)-3-methyl-4-[(Z)-2-methylbut-2-enoyl]oxybut-2-enoate |
|---|---|
| PubChem CID | 162957936 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [(1R,2R,8aR)-5-hydroxy-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (Z)-3-methyl-4-[(Z)-2-methylbut-2-enoyl]oxybut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC/C(C)=C\C(=O)O[C@@H]1CCC2=C(O)C(=O)C(=C(C)C)C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C25H34O6/c1-8-16(5)24(29)30-13-15(4)11-21(26)31-20-10-9-19-23(28)22(27)18(14(2)3)12-25(19,7)17(20)6/h8,11,17,20,28H,9-10,12-13H2,1-7H3/b15-11-,16-8-/t17-,20+,25+/m0/s1 |
| InChIKey | JCOHWGZUTSZMSX-UZOUQCFNSA-N |
| XLogP | 4.91 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|