C20H28O4 — CID 163022414
[(4aR,5R,6S,8aS)-8a-hydroxy-3,4a,5-trimethyl-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-6-yl] 2-methylbut-2-enoate (PubChem CID 163022414) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(4aR,5R,6S,8aS)-8a-hydroxy-3,4a,5-trimethyl-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-6-yl] 2-methylbut-2-enoate.
| Compound Name | [(4aR,5R,6S,8aS)-8a-hydroxy-3,4a,5-trimethyl-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-6-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163022414 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(4aR,5R,6S,8aS)-8a-hydroxy-3,4a,5-trimethyl-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-6-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@H]1CC[C@]2(O)Cc3occ(C)c3C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C20H28O4/c1-6-12(2)18(21)24-16-7-8-20(22)10-17-15(13(3)11-23-17)9-19(20,5)14(16)4/h6,11,14,16,22H,7-10H2,1-5H3/t14-,16-,19+,20-/m0/s1 |
| InChIKey | GXUMIIXHSIMDQI-UQOODKLHSA-N |
| XLogP | 3.73 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|