C20H26O5 — CID 162972351
[(1S,8S,9S,10R,11S,13R)-8-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-11-yl] 2-methylbut-2-enoate (PubChem CID 162972351) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is [(1S,8S,9S,10R,11S,13R)-8-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-11-yl] 2-methylbut-2-enoate.
| Compound Name | [(1S,8S,9S,10R,11S,13R)-8-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-11-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162972351 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(1S,8S,9S,10R,11S,13R)-8-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-11-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@H]1C[C@H]2O[C@]23Cc2occ(C)c2[C@@H](O)[C@]3(C)[C@H]1C |
| InChI | InChI=1S/C20H26O5/c1-6-10(2)18(22)24-13-7-15-20(25-15)8-14-16(11(3)9-23-14)17(21)19(20,5)12(13)4/h6,9,12-13,15,17,21H,7-8H2,1-5H3/t12-,13-,15+,17+,19-,20+/m0/s1 |
| InChIKey | HLIIVYQEGUVQGH-JZGYDQJDSA-N |
| XLogP | 3.24 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|