C25H34O5 — CID 162957906
[(4aS,5R,6S,7S,8aS)-3,4a,5-trimethyl-6-(2-methylbut-2-enoyloxy)-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-7-yl] 2-methylbut-2-enoate (PubChem CID 162957906) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is [(4aS,5R,6S,7S,8aS)-3,4a,5-trimethyl-6-(2-methylbut-2-enoyloxy)-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-7-yl] 2-methylbut-2-enoate.
| Compound Name | [(4aS,5R,6S,7S,8aS)-3,4a,5-trimethyl-6-(2-methylbut-2-enoyloxy)-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-7-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162957906 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | [(4aS,5R,6S,7S,8aS)-3,4a,5-trimethyl-6-(2-methylbut-2-enoyloxy)-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-7-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@@H]1[C@@H](OC(=O)C(C)=CC)C[C@H]2Cc3occ(C)c3C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C25H34O5/c1-8-14(3)23(26)29-21-11-18-10-20-19(16(5)13-28-20)12-25(18,7)17(6)22(21)30-24(27)15(4)9-2/h8-9,13,17-18,21-22H,10-12H2,1-7H3/t17-,18+,21-,22-,25+/m0/s1 |
| InChIKey | VFXPFKHNRXPZTI-DVMBGTJSSA-N |
| XLogP | 5.10 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|