C19H26O3 — CID 162876583
[(4aS,5R,6R,8aS)-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-6-yl] but-2-enoate (PubChem CID 162876583) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is [(4aS,5R,6R,8aS)-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-6-yl] but-2-enoate.
| Compound Name | [(4aS,5R,6R,8aS)-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-6-yl] but-2-enoate |
|---|---|
| PubChem CID | 162876583 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [(4aS,5R,6R,8aS)-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-6-yl] but-2-enoate |
| SMILES | CC=CC(=O)O[C@@H]1CC[C@H]2Cc3occ(C)c3C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C19H26O3/c1-5-6-18(20)22-16-8-7-14-9-17-15(12(2)11-21-17)10-19(14,4)13(16)3/h5-6,11,13-14,16H,7-10H2,1-4H3/t13-,14-,16+,19+/m0/s1 |
| InChIKey | HJDSLSHZAIXWMV-QRCPMIHRSA-N |
| XLogP | 4.23 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|