C19H24O3 — CID 162983642
[(4aR,5R,6S)-3,4a,5-trimethyl-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-6-yl] 2-methylprop-2-enoate (PubChem CID 162983642) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is [(4aR,5R,6S)-3,4a,5-trimethyl-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-6-yl] 2-methylprop-2-enoate.
| Compound Name | [(4aR,5R,6S)-3,4a,5-trimethyl-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-6-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162983642 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | [(4aR,5R,6S)-3,4a,5-trimethyl-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-6-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1CC=C2Cc3occ(C)c3C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C19H24O3/c1-11(2)18(20)22-16-7-6-14-8-17-15(12(3)10-21-17)9-19(14,5)13(16)4/h6,10,13,16H,1,7-9H2,2-5H3/t13-,16-,19+/m0/s1 |
| InChIKey | QQVRIMHAWJJLMU-IYJAJMOOSA-N |
| XLogP | 4.15 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|