C40H78O — CID 162958827
(2S,3R)-2-methyl-3-[(E,8R,12R)-4,8,12,16-tetramethylheptadec-3-enyl]-2-[(4R,8R)-4,8,12-trimethyltridecyl]oxirane (PubChem CID 162958827) has the molecular formula C40H78O and a molecular weight of 575.06 g/mol. Its IUPAC name is (2S,3R)-2-methyl-3-[(E,8R,12R)-4,8,12,16-tetramethylheptadec-3-enyl]-2-[(4R,8R)-4,8,12-trimethyltridecyl]oxirane.
| Compound Name | (2S,3R)-2-methyl-3-[(E,8R,12R)-4,8,12,16-tetramethylheptadec-3-enyl]-2-[(4R,8R)-4,8,12-trimethyltridecyl]oxirane |
|---|---|
| PubChem CID | 162958827 |
| Molecular Formula | C40H78O |
| Molecular Weight | 575.06 g/mol |
| Exact Mass | 574.61 |
| IUPAC Name | (2S,3R)-2-methyl-3-[(E,8R,12R)-4,8,12,16-tetramethylheptadec-3-enyl]-2-[(4R,8R)-4,8,12-trimethyltridecyl]oxirane |
| SMILES | C/C(=C\CC[C@H]1O[C@@]1(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C40H78O/c1-32(2)18-11-20-34(5)22-13-24-36(7)25-14-26-37(8)28-16-30-39-40(10,41-39)31-17-29-38(9)27-15-23-35(6)21-12-19-33(3)4/h28,32-36,38-39H,11-27,29-31H2,1-10H3/b37-28+/t34-,35-,36-,38-,39-,40+/m1/s1 |
| InChIKey | WZSNNMXVZLQRAE-RDUQQMHHSA-N |
| XLogP | 13.75 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.06 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|