C25H40O6 — CID 162959801
[(2R)-3,3-dimethylundecan-2-yl] 4-acetyl-2,3,6-trimethoxybenzoate (PubChem CID 162959801) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(2R)-3,3-dimethylundecan-2-yl] 4-acetyl-2,3,6-trimethoxybenzoate.
| Compound Name | [(2R)-3,3-dimethylundecan-2-yl] 4-acetyl-2,3,6-trimethoxybenzoate |
|---|---|
| PubChem CID | 162959801 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [(2R)-3,3-dimethylundecan-2-yl] 4-acetyl-2,3,6-trimethoxybenzoate |
| SMILES | CCCCCCCCC(C)(C)[C@@H](C)OC(=O)c1c(OC)cc(C(C)=O)c(OC)c1OC |
| InChI | InChI=1S/C25H40O6/c1-9-10-11-12-13-14-15-25(4,5)18(3)31-24(27)21-20(28-6)16-19(17(2)26)22(29-7)23(21)30-8/h16,18H,9-15H2,1-8H3/t18-/m1/s1 |
| InChIKey | WOLAARGQWGYOTJ-GOSISDBHSA-N |
| XLogP | 6.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|