C19H29BrO3 — CID 23246210
1-[4-(8-bromo-2-methyloctan-2-yl)-2,6-dimethoxyphenyl]ethanone (PubChem CID 23246210) has the molecular formula C19H29BrO3 and a molecular weight of 385.34 g/mol. Its IUPAC name is 1-[4-(8-bromo-2-methyloctan-2-yl)-2,6-dimethoxyphenyl]ethanone.
| Compound Name | 1-[4-(8-bromo-2-methyloctan-2-yl)-2,6-dimethoxyphenyl]ethanone |
|---|---|
| PubChem CID | 23246210 |
| Molecular Formula | C19H29BrO3 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[4-(8-bromo-2-methyloctan-2-yl)-2,6-dimethoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)(C)CCCCCCBr)cc(OC)c1C(C)=O |
| InChI | InChI=1S/C19H29BrO3/c1-14(21)18-16(22-4)12-15(13-17(18)23-5)19(2,3)10-8-6-7-9-11-20/h12-13H,6-11H2,1-5H3 |
| InChIKey | QABXTCRPKIJZBF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|