C21H31BrO3 — CID 23246211
1-[4-(8-bromo-2-methyloctan-2-yl)-2-methoxy-6-prop-2-enoxyphenyl]ethanone (PubChem CID 23246211) has the molecular formula C21H31BrO3 and a molecular weight of 411.38 g/mol. Its IUPAC name is 1-[4-(8-bromo-2-methyloctan-2-yl)-2-methoxy-6-prop-2-enoxyphenyl]ethanone.
| Compound Name | 1-[4-(8-bromo-2-methyloctan-2-yl)-2-methoxy-6-prop-2-enoxyphenyl]ethanone |
|---|---|
| PubChem CID | 23246211 |
| Molecular Formula | C21H31BrO3 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-[4-(8-bromo-2-methyloctan-2-yl)-2-methoxy-6-prop-2-enoxyphenyl]ethanone |
| SMILES | C=CCOc1cc(C(C)(C)CCCCCCBr)cc(OC)c1C(C)=O |
| InChI | InChI=1S/C21H31BrO3/c1-6-13-25-19-15-17(14-18(24-5)20(19)16(2)23)21(3,4)11-9-7-8-10-12-22/h6,14-15H,1,7-13H2,2-5H3 |
| InChIKey | XLRNXFVOKLWPOO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|