C22H21BrO4 — CID 67347655
(E)-3-(4-bromophenyl)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]prop-2-en-1-one (PubChem CID 67347655) has the molecular formula C22H21BrO4 and a molecular weight of 429.31 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-bromophenyl)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 67347655 |
| Molecular Formula | C22H21BrO4 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | (E)-3-(4-bromophenyl)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]prop-2-en-1-one |
| SMILES | C=CCOc1cc(OC)c(C(=O)/C=C/c2ccc(Br)cc2)c(OCC=C)c1 |
| InChI | InChI=1S/C22H21BrO4/c1-4-12-26-18-14-20(25-3)22(21(15-18)27-13-5-2)19(24)11-8-16-6-9-17(23)10-7-16/h4-11,14-15H,1-2,12-13H2,3H3/b11-8+ |
| InChIKey | XMWRYUGUASAWLH-DHZHZOJOSA-N |
| XLogP | 5.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|