C10H20O3 — CID 162963121
(2S,3S,4R,5S)-4-ethyl-3-methyl-5-propyloxolane-2,3-diol (PubChem CID 162963121) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2S,3S,4R,5S)-4-ethyl-3-methyl-5-propyloxolane-2,3-diol.
| Compound Name | (2S,3S,4R,5S)-4-ethyl-3-methyl-5-propyloxolane-2,3-diol |
|---|---|
| PubChem CID | 162963121 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (2S,3S,4R,5S)-4-ethyl-3-methyl-5-propyloxolane-2,3-diol |
| SMILES | CCC[C@@H]1O[C@H](O)[C@@](C)(O)[C@@H]1CC |
| InChI | InChI=1S/C10H20O3/c1-4-6-8-7(5-2)10(3,12)9(11)13-8/h7-9,11-12H,4-6H2,1-3H3/t7-,8+,9+,10+/m1/s1 |
| InChIKey | FSFWUMOVZGOJDP-KATARQTJSA-N |
| XLogP | 1.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |