C9H16O4 — CID 101357742
(3S,3aS,4S,6aR)-3-propyl-3,3a,4,6-tetrahydro-1H-furo[3,4-c]furan-4,6a-diol (PubChem CID 101357742) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is (3S,3aS,4S,6aR)-3-propyl-3,3a,4,6-tetrahydro-1H-furo[3,4-c]furan-4,6a-diol.
| Compound Name | (3S,3aS,4S,6aR)-3-propyl-3,3a,4,6-tetrahydro-1H-furo[3,4-c]furan-4,6a-diol |
|---|---|
| PubChem CID | 101357742 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (3S,3aS,4S,6aR)-3-propyl-3,3a,4,6-tetrahydro-1H-furo[3,4-c]furan-4,6a-diol |
| SMILES | CCC[C@@H]1OC[C@@]2(O)CO[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C9H16O4/c1-2-3-6-7-8(10)13-5-9(7,11)4-12-6/h6-8,10-11H,2-5H2,1H3/t6-,7+,8-,9+/m0/s1 |
| InChIKey | SHPWLJJDOPMOPG-UYXSQOIJSA-N |
| XLogP | -0.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |