C20H30O6S — CID 162963359
(1S,4aR,4bS,7R,10aS)-1,4a,7-trimethyl-7-(2-sulfooxyethyl)-3,4,4b,5,6,10a-hexahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 162963359) has the molecular formula C20H30O6S and a molecular weight of 398.52 g/mol. Its IUPAC name is (1S,4aR,4bS,7R,10aS)-1,4a,7-trimethyl-7-(2-sulfooxyethyl)-3,4,4b,5,6,10a-hexahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1S,4aR,4bS,7R,10aS)-1,4a,7-trimethyl-7-(2-sulfooxyethyl)-3,4,4b,5,6,10a-hexahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 162963359 |
| Molecular Formula | C20H30O6S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (1S,4aR,4bS,7R,10aS)-1,4a,7-trimethyl-7-(2-sulfooxyethyl)-3,4,4b,5,6,10a-hexahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | C[C@@]1(CCOS(=O)(=O)O)C=C2C=C[C@H]3[C@](C)(CCC[C@]3(C)C(=O)O)[C@@H]2CC1 |
| InChI | InChI=1S/C20H30O6S/c1-18(11-12-26-27(23,24)25)10-7-15-14(13-18)5-6-16-19(15,2)8-4-9-20(16,3)17(21)22/h5-6,13,15-16H,4,7-12H2,1-3H3,(H,21,22)(H,23,24,25)/t15-,16+,18-,19-,20+/m1/s1 |
| InChIKey | XQLPUWHKBGVFNW-LHDHZVESSA-N |
| XLogP | 4.01 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|