C17H20O — CID 162964394
4-[(1R,4aS,8aS)-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]benzaldehyde (PubChem CID 162964394) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 4-[(1R,4aS,8aS)-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]benzaldehyde.
| Compound Name | 4-[(1R,4aS,8aS)-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 162964394 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-[(1R,4aS,8aS)-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]benzaldehyde |
| SMILES | O=Cc1ccc([C@@H]2CC=C[C@@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C17H20O/c18-12-13-8-10-15(11-9-13)17-7-3-5-14-4-1-2-6-16(14)17/h3,5,8-12,14,16-17H,1-2,4,6-7H2/t14-,16-,17-/m0/s1 |
| InChIKey | AAKSZKGMJDMLKF-XIRDDKMYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|