C20H30O4 — CID 162964661
10a-hydroperoxy-2-(1-hydroxypropan-2-yl)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-one (PubChem CID 162964661) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 10a-hydroperoxy-2-(1-hydroxypropan-2-yl)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-one.
| Compound Name | 10a-hydroperoxy-2-(1-hydroxypropan-2-yl)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-one |
|---|---|
| PubChem CID | 162964661 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 10a-hydroperoxy-2-(1-hydroxypropan-2-yl)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-one |
| SMILES | CC(CO)C1=CC2(OO)CCC3C(C)(C)CCCC3(C)C2=CC1=O |
| InChI | InChI=1S/C20H30O4/c1-13(12-21)14-11-20(24-23)9-6-16-18(2,3)7-5-8-19(16,4)17(20)10-15(14)22/h10-11,13,16,21,23H,5-9,12H2,1-4H3 |
| InChIKey | ZMWOJBQXCGBPPW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|