C20H30O5 — CID 101453505
5-[(Z)-[(2R,4aS,8aS)-2-hydroperoxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-ylidene]methyl]-5-hydroxy-4-methylfuran-2-one (PubChem CID 101453505) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 5-[(Z)-[(2R,4aS,8aS)-2-hydroperoxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-ylidene]methyl]-5-hydroxy-4-methylfuran-2-one.
| Compound Name | 5-[(Z)-[(2R,4aS,8aS)-2-hydroperoxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-ylidene]methyl]-5-hydroxy-4-methylfuran-2-one |
|---|---|
| PubChem CID | 101453505 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 5-[(Z)-[(2R,4aS,8aS)-2-hydroperoxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-ylidene]methyl]-5-hydroxy-4-methylfuran-2-one |
| SMILES | CC1=CC(=O)OC1(O)/C=C1\[C@](C)(OO)CC[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C20H30O5/c1-13-11-16(21)24-20(13,22)12-15-18(4)9-6-8-17(2,3)14(18)7-10-19(15,5)25-23/h11-12,14,22-23H,6-10H2,1-5H3/b15-12-/t14-,18-,19+,20?/m0/s1 |
| InChIKey | KHZWPARLIFJXQW-CTYDCGHRSA-N |
| XLogP | 3.98 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|