C21H30O3 — CID 11110333
[(3aS,5aR,9aR)-3-acetyl-3a,6,6,9a-tetramethyl-4,5,5a,7,8,9-hexahydrocyclopenta[a]naphthalen-1-yl] acetate (PubChem CID 11110333) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is [(3aS,5aR,9aR)-3-acetyl-3a,6,6,9a-tetramethyl-4,5,5a,7,8,9-hexahydrocyclopenta[a]naphthalen-1-yl] acetate.
| Compound Name | [(3aS,5aR,9aR)-3-acetyl-3a,6,6,9a-tetramethyl-4,5,5a,7,8,9-hexahydrocyclopenta[a]naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 11110333 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [(3aS,5aR,9aR)-3-acetyl-3a,6,6,9a-tetramethyl-4,5,5a,7,8,9-hexahydrocyclopenta[a]naphthalen-1-yl] acetate |
| SMILES | CC(=O)OC1=C2[C@](C)(CC[C@@H]3C(C)(C)CCC[C@@]23C)C(C(C)=O)=C1 |
| InChI | InChI=1S/C21H30O3/c1-13(22)15-12-16(24-14(2)23)18-20(15,5)11-8-17-19(3,4)9-7-10-21(17,18)6/h12,17H,7-11H2,1-6H3/t17-,20-,21-/m1/s1 |
| InChIKey | JJXLJDPRFBHWQK-DUXKGJEZSA-N |
| XLogP | 4.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |