About (3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate
(3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate (PubChem CID 11129114) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is (3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate.
Analyze (3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate?
The IUPAC name of (3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate (CID 11129114) is (3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate.
What is the SMILES notation for (3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate?
The canonical SMILES for (3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate is CC(=O)OC1=C2C(C)(C)CCCC2(C)C(C(C)=O)=C1.
What is the InChIKey of (3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate?
The InChIKey is WYDSRQXVAFTQKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-10(17)12-9-13(19-11(2)18)14-15(3,4)7-6-8-16(12,14)5/h9H,6-8H2,1-5H3.
What are the key properties of (3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate?
(3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate has a molecular weight of 262.35 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetyl-3a,7,7-trimethyl-5,6-dihydro-4H-inden-1-yl) acetate is sourced from PubChem (CID 11129114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).