C17H24O3 — CID 135042007
[2-hydroxy-6-methyl-3-[(1S)-1,2,2-trimethylcyclopentyl]phenyl] acetate (PubChem CID 135042007) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is [2-hydroxy-6-methyl-3-[(1S)-1,2,2-trimethylcyclopentyl]phenyl] acetate.
| Compound Name | [2-hydroxy-6-methyl-3-[(1S)-1,2,2-trimethylcyclopentyl]phenyl] acetate |
|---|---|
| PubChem CID | 135042007 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [2-hydroxy-6-methyl-3-[(1S)-1,2,2-trimethylcyclopentyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(C)ccc([C@@]2(C)CCCC2(C)C)c1O |
| InChI | InChI=1S/C17H24O3/c1-11-7-8-13(14(19)15(11)20-12(2)18)17(5)10-6-9-16(17,3)4/h7-8,19H,6,9-10H2,1-5H3/t17-/m1/s1 |
| InChIKey | ALVJGDZBQJUCIB-QGZVFWFLSA-N |
| XLogP | 4.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|