C25H33BO7 — CID 71736477
[(2R,7R)-15,16-diacetyloxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid (PubChem CID 71736477) has the molecular formula C25H33BO7 and a molecular weight of 456.34 g/mol. Its IUPAC name is [(2R,7R)-15,16-diacetyloxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid.
| Compound Name | [(2R,7R)-15,16-diacetyloxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid |
|---|---|
| PubChem CID | 71736477 |
| Molecular Formula | C25H33BO7 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | [(2R,7R)-15,16-diacetyloxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid |
| SMILES | CC(=O)Oc1cc2c3c(oc2c(B(O)O)c1OC(C)=O)C(C)CC[C@@H]1C(C)(C)CCC[C@@]31C |
| InChI | InChI=1S/C25H33BO7/c1-13-8-9-18-24(4,5)10-7-11-25(18,6)19-16-12-17(31-14(2)27)23(32-15(3)28)20(26(29)30)22(16)33-21(13)19/h12-13,18,29-30H,7-11H2,1-6H3/t13?,18-,25-/m1/s1 |
| InChIKey | SNKDWYQITVFEEP-ILIXYTCYSA-N |
| XLogP | 3.94 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|