C22H31BO4 — CID 71736473
[(2R,7R)-15,16-dihydroxy-2,6,6,10-tetramethyl-14-tetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraenyl]boronic acid (PubChem CID 71736473) has the molecular formula C22H31BO4 and a molecular weight of 370.30 g/mol. Its IUPAC name is [(2R,7R)-15,16-dihydroxy-2,6,6,10-tetramethyl-14-tetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraenyl]boronic acid.
| Compound Name | [(2R,7R)-15,16-dihydroxy-2,6,6,10-tetramethyl-14-tetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraenyl]boronic acid |
|---|---|
| PubChem CID | 71736473 |
| Molecular Formula | C22H31BO4 |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | [(2R,7R)-15,16-dihydroxy-2,6,6,10-tetramethyl-14-tetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraenyl]boronic acid |
| SMILES | CC1CC[C@@H]2C(C)(C)CCC[C@@]2(C)C2=C1Cc1c2cc(O)c(O)c1B(O)O |
| InChI | InChI=1S/C22H31BO4/c1-12-6-7-17-21(2,3)8-5-9-22(17,4)18-13(12)10-15-14(18)11-16(24)20(25)19(15)23(26)27/h11-12,17,24-27H,5-10H2,1-4H3/t12?,17-,22-/m1/s1 |
| InChIKey | ZKQKEEMGKODOGO-OJNPPMJPSA-N |
| XLogP | 3.35 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|