C22H30O7S — CID 162883733
[6-[(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene)methyl]-2-formyl-3,4-dihydroxyphenyl] hydrogen sulfate (PubChem CID 162883733) has the molecular formula C22H30O7S and a molecular weight of 438.54 g/mol. Its IUPAC name is [6-[(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene)methyl]-2-formyl-3,4-dihydroxyphenyl] hydrogen sulfate.
| Compound Name | [6-[(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene)methyl]-2-formyl-3,4-dihydroxyphenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 162883733 |
| Molecular Formula | C22H30O7S |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [6-[(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene)methyl]-2-formyl-3,4-dihydroxyphenyl] hydrogen sulfate |
| SMILES | CC1CCC2C(C)(C)CCCC2(C)C1=Cc1cc(O)c(O)c(C=O)c1OS(=O)(=O)O |
| InChI | InChI=1S/C22H30O7S/c1-13-6-7-18-21(2,3)8-5-9-22(18,4)16(13)10-14-11-17(24)19(25)15(12-23)20(14)29-30(26,27)28/h10-13,18,24-25H,5-9H2,1-4H3,(H,26,27,28) |
| InChIKey | MMPODADSKBDMPK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|