C22H30O10S2 — CID 163031060
[5-[(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene)methyl]-3-formyl-2-hydroxy-4-sulfooxyphenyl] hydrogen sulfate (PubChem CID 163031060) has the molecular formula C22H30O10S2 and a molecular weight of 518.61 g/mol. Its IUPAC name is [5-[(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene)methyl]-3-formyl-2-hydroxy-4-sulfooxyphenyl] hydrogen sulfate.
| Compound Name | [5-[(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene)methyl]-3-formyl-2-hydroxy-4-sulfooxyphenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 163031060 |
| Molecular Formula | C22H30O10S2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | [5-[(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene)methyl]-3-formyl-2-hydroxy-4-sulfooxyphenyl] hydrogen sulfate |
| SMILES | CC1CCC2C(C)(C)CCCC2(C)C1=Cc1cc(OS(=O)(=O)O)c(O)c(C=O)c1OS(=O)(=O)O |
| InChI | InChI=1S/C22H30O10S2/c1-13-6-7-18-21(2,3)8-5-9-22(18,4)16(13)10-14-11-17(31-33(25,26)27)19(24)15(12-23)20(14)32-34(28,29)30/h10-13,18,24H,5-9H2,1-4H3,(H,25,26,27)(H,28,29,30) |
| InChIKey | VFBOORDDCFDMAN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|