C22H32O7S — CID 163163827
[2-[[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-3-formyl-4-hydroxyphenyl] hydrogen sulfate (PubChem CID 163163827) has the molecular formula C22H32O7S and a molecular weight of 440.56 g/mol. Its IUPAC name is [2-[[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-3-formyl-4-hydroxyphenyl] hydrogen sulfate.
| Compound Name | [2-[[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-3-formyl-4-hydroxyphenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 163163827 |
| Molecular Formula | C22H32O7S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [2-[[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-3-formyl-4-hydroxyphenyl] hydrogen sulfate |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](Cc3c(OS(=O)(=O)O)ccc(O)c3C=O)[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C22H32O7S/c1-20(2)9-5-10-21(3)18(20)8-11-22(4,25)19(21)12-14-15(13-23)16(24)6-7-17(14)29-30(26,27)28/h6-7,13,18-19,24-25H,5,8-12H2,1-4H3,(H,26,27,28)/t18-,19+,21-,22+/m0/s1 |
| InChIKey | RYXAFXKDHMONBM-YUVXSKOASA-N |
| XLogP | 3.92 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|