C26H36O4 — CID 132534909
6-[(E)-[(2R,4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene]methyl]-5-methoxy-2,2-dimethyl-1,3-benzodioxole-4-carbaldehyde (PubChem CID 132534909) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 6-[(E)-[(2R,4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene]methyl]-5-methoxy-2,2-dimethyl-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 6-[(E)-[(2R,4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene]methyl]-5-methoxy-2,2-dimethyl-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 132534909 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 6-[(E)-[(2R,4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ylidene]methyl]-5-methoxy-2,2-dimethyl-1,3-benzodioxole-4-carbaldehyde |
| SMILES | COc1c(/C=C2\[C@H](C)CC[C@H]3C(C)(C)CCC[C@]23C)cc2c(c1C=O)OC(C)(C)O2 |
| InChI | InChI=1S/C26H36O4/c1-16-9-10-21-24(2,3)11-8-12-26(21,6)19(16)13-17-14-20-23(30-25(4,5)29-20)18(15-27)22(17)28-7/h13-16,21H,8-12H2,1-7H3/b19-13+/t16-,21+,26-/m1/s1 |
| InChIKey | COMWWWNCJRLXQA-YGYGYDPWSA-N |
| XLogP | 6.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|