C20H32O4 — CID 162968049
(1-acetyl-4-hydroxy-7-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-4-yl)methyl 2-methylbut-2-enoate (PubChem CID 162968049) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1-acetyl-4-hydroxy-7-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-4-yl)methyl 2-methylbut-2-enoate.
| Compound Name | (1-acetyl-4-hydroxy-7-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-4-yl)methyl 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162968049 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1-acetyl-4-hydroxy-7-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-4-yl)methyl 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OCC1(O)CCC(C(C)C)C2C(C(C)=O)CCC21 |
| InChI | InChI=1S/C20H32O4/c1-6-13(4)19(22)24-11-20(23)10-9-15(12(2)3)18-16(14(5)21)7-8-17(18)20/h6,12,15-18,23H,7-11H2,1-5H3 |
| InChIKey | HCLBHWFWGBSTRW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|