C20H34O5 — CID 162974221
(2R,3R,4S,5R)-2-[(2R)-2-methyl-5-[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]pentoxy]oxane-3,4,5-triol (PubChem CID 162974221) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[(2R)-2-methyl-5-[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]pentoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-[(2R)-2-methyl-5-[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]pentoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162974221 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (2R,3R,4S,5R)-2-[(2R)-2-methyl-5-[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]pentoxy]oxane-3,4,5-triol |
| SMILES | C=C(C)[C@H]1CC=C(CCC[C@@H](C)CO[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)CC1 |
| InChI | InChI=1S/C20H34O5/c1-13(2)16-9-7-15(8-10-16)6-4-5-14(3)11-24-20-19(23)18(22)17(21)12-25-20/h7,14,16-23H,1,4-6,8-12H2,2-3H3/t14-,16+,17-,18+,19-,20-/m1/s1 |
| InChIKey | GURCFOSKFBVVCE-RRWCZSPKSA-N |
| XLogP | 2.55 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|