C41H58O2 — CID 162977030
3,5,5-trimethyl-4-[3,7,12,16-tetramethyl-18-(2,2,4,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-2-en-1-ol (PubChem CID 162977030) has the molecular formula C41H58O2 and a molecular weight of 582.91 g/mol. Its IUPAC name is 3,5,5-trimethyl-4-[3,7,12,16-tetramethyl-18-(2,2,4,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-2-en-1-ol.
| Compound Name | 3,5,5-trimethyl-4-[3,7,12,16-tetramethyl-18-(2,2,4,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 162977030 |
| Molecular Formula | C41H58O2 |
| Molecular Weight | 582.91 g/mol |
| Exact Mass | 582.44 |
| IUPAC Name | 3,5,5-trimethyl-4-[3,7,12,16-tetramethyl-18-(2,2,4,6-tetramethyl-7-oxabicyclo[4.1.0]heptan-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-2-en-1-ol |
| SMILES | CC(C=CC=C(C)C=CC1C(C)=CC(O)CC1(C)C)=CC=CC=C(C)C=CC=C(C)C=CC12OC1(C)CC(C)CC2(C)C |
| InChI | InChI=1S/C41H58O2/c1-30(18-14-20-32(3)22-23-37-35(6)26-36(42)29-38(37,7)8)16-12-13-17-31(2)19-15-21-33(4)24-25-41-39(9,10)27-34(5)28-40(41,11)43-41/h12-26,34,36-37,42H,27-29H2,1-11H3 |
| InChIKey | BIVIKXQHDMPIQD-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.91 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|