C23H38O5 — CID 162977645
[(2S)-2,3-dihydroxypropyl] (2S)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoate (PubChem CID 162977645) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is [(2S)-2,3-dihydroxypropyl] (2S)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoate.
| Compound Name | [(2S)-2,3-dihydroxypropyl] (2S)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoate |
|---|---|
| PubChem CID | 162977645 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | [(2S)-2,3-dihydroxypropyl] (2S)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoate |
| SMILES | C=CCCCCC(C)CCCC=CC#CCC[C@H](OC)C(=O)OC[C@@H](O)CO |
| InChI | InChI=1S/C23H38O5/c1-4-5-6-12-15-20(2)16-13-10-8-7-9-11-14-17-22(27-3)23(26)28-19-21(25)18-24/h4,7-8,20-22,24-25H,1,5-6,10,12-19H2,2-3H3/t20?,21-,22-/m0/s1 |
| InChIKey | ZOURGFUMJSSZCY-QIFDKBNDSA-N |
| XLogP | 3.79 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|