C38H50O6 — CID 162978775
8-(3,4-dihydroxybenzoyl)-2,2-dimethyl-3,6-bis(3-methylbut-2-enyl)-4a-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)-3,4-dihydrochromene-5,7-dione (PubChem CID 162978775) has the molecular formula C38H50O6 and a molecular weight of 602.81 g/mol. Its IUPAC name is 8-(3,4-dihydroxybenzoyl)-2,2-dimethyl-3,6-bis(3-methylbut-2-enyl)-4a-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)-3,4-dihydrochromene-5,7-dione.
| Compound Name | 8-(3,4-dihydroxybenzoyl)-2,2-dimethyl-3,6-bis(3-methylbut-2-enyl)-4a-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)-3,4-dihydrochromene-5,7-dione |
|---|---|
| PubChem CID | 162978775 |
| Molecular Formula | C38H50O6 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | 8-(3,4-dihydroxybenzoyl)-2,2-dimethyl-3,6-bis(3-methylbut-2-enyl)-4a-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)-3,4-dihydrochromene-5,7-dione |
| SMILES | C=C(C)C(CC=C(C)C)CC12CC(CC=C(C)C)C(C)(C)OC1=C(C(=O)c1ccc(O)c(O)c1)C(=O)C(CC=C(C)C)C2=O |
| InChI | InChI=1S/C38H50O6/c1-22(2)11-14-27(25(7)8)20-38-21-28(16-12-23(3)4)37(9,10)44-36(38)32(33(41)26-15-18-30(39)31(40)19-26)34(42)29(35(38)43)17-13-24(5)6/h11-13,15,18-19,27-29,39-40H,7,14,16-17,20-21H2,1-6,8-10H3 |
| InChIKey | KUESLMSPVYLPDD-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|