C17H13NO4 — CID 162980534
13-hydroxy-14-(hydroxymethyl)-15-methoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,12(16),13-heptaen-11-one (PubChem CID 162980534) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is 13-hydroxy-14-(hydroxymethyl)-15-methoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,12(16),13-heptaen-11-one.
| Compound Name | 13-hydroxy-14-(hydroxymethyl)-15-methoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,12(16),13-heptaen-11-one |
|---|---|
| PubChem CID | 162980534 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 13-hydroxy-14-(hydroxymethyl)-15-methoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,12(16),13-heptaen-11-one |
| SMILES | COc1c(CO)c(O)c2c3c(cc4ccccc4c13)NC2=O |
| InChI | InChI=1S/C17H13NO4/c1-22-16-10(7-19)15(20)14-13-11(18-17(14)21)6-8-4-2-3-5-9(8)12(13)16/h2-6,19-20H,7H2,1H3,(H,18,21) |
| InChIKey | ITLTZOSZPJKABH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|