C18H15NO4 — CID 163027933
14-(hydroxymethyl)-13,15-dimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one (PubChem CID 163027933) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 14-(hydroxymethyl)-13,15-dimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one.
| Compound Name | 14-(hydroxymethyl)-13,15-dimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one |
|---|---|
| PubChem CID | 163027933 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 14-(hydroxymethyl)-13,15-dimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one |
| SMILES | COc1c(CO)c(OC)c2c3c(cc4ccccc42)NC(=O)c13 |
| InChI | InChI=1S/C18H15NO4/c1-22-16-11(8-20)17(23-2)15-14-12(19-18(15)21)7-9-5-3-4-6-10(9)13(14)16/h3-7,20H,8H2,1-2H3,(H,19,21) |
| InChIKey | VBIDNLIIQJCANU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|