C19H17NO5 — CID 162874032
13-(hydroxymethyl)-4,14,15-trimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one (PubChem CID 162874032) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 13-(hydroxymethyl)-4,14,15-trimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one.
| Compound Name | 13-(hydroxymethyl)-4,14,15-trimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one |
|---|---|
| PubChem CID | 162874032 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 13-(hydroxymethyl)-4,14,15-trimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one |
| SMILES | COc1ccc2cc3c4c(c(CO)c(OC)c(OC)c4c2c1)C(=O)N3 |
| InChI | InChI=1S/C19H17NO5/c1-23-10-5-4-9-6-13-16-14(11(9)7-10)18(25-3)17(24-2)12(8-21)15(16)19(22)20-13/h4-7,21H,8H2,1-3H3,(H,20,22) |
| InChIKey | SEFRVZVTQHSNOP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|