C26H25ClN2O6 — CID 162981261
7-chloro-4,6-dimethoxy-5'-methyl-3'-[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)amino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 162981261) has the molecular formula C26H25ClN2O6 and a molecular weight of 496.95 g/mol. Its IUPAC name is 7-chloro-4,6-dimethoxy-5'-methyl-3'-[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)amino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | 7-chloro-4,6-dimethoxy-5'-methyl-3'-[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)amino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 162981261 |
| Molecular Formula | C26H25ClN2O6 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 7-chloro-4,6-dimethoxy-5'-methyl-3'-[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)amino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C(=O)C=C(NC3CCc4ccccc4NC3=O)CC1C)C2=O |
| InChI | InChI=1S/C26H25ClN2O6/c1-13-10-15(28-17-9-8-14-6-4-5-7-16(14)29-25(17)32)11-20(30)26(13)24(31)21-18(33-2)12-19(34-3)22(27)23(21)35-26/h4-7,11-13,17,28H,8-10H2,1-3H3,(H,29,32) |
| InChIKey | PVKAYUYALRJJCG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|